C13H16N4O — CID 82478568
2-[3-(5,6-dimethyl-1,2,4-triazin-3-yl)phenoxy]ethanamine (PubChem CID 82478568) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[3-(5,6-dimethyl-1,2,4-triazin-3-yl)phenoxy]ethanamine.
| Compound Name | 2-[3-(5,6-dimethyl-1,2,4-triazin-3-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 82478568 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[3-(5,6-dimethyl-1,2,4-triazin-3-yl)phenoxy]ethanamine |
| SMILES | Cc1nnc(-c2cccc(OCCN)c2)nc1C |
| InChI | InChI=1S/C13H16N4O/c1-9-10(2)16-17-13(15-9)11-4-3-5-12(8-11)18-7-6-14/h3-5,8H,6-7,14H2,1-2H3 |
| InChIKey | MYTVBKNWRYGHOM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |