C10H9FN4O — CID 176800053
3-[3-(2-(18F)fluoroethoxy)phenyl]-1,2,4,5-tetrazine (PubChem CID 176800053) has the molecular formula C10H9FN4O and a molecular weight of 219.21 g/mol. Its IUPAC name is 3-[3-(2-(18F)fluoroethoxy)phenyl]-1,2,4,5-tetrazine.
| Compound Name | 3-[3-(2-(18F)fluoroethoxy)phenyl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 176800053 |
| Molecular Formula | C10H9FN4O |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-[3-(2-(18F)fluoroethoxy)phenyl]-1,2,4,5-tetrazine |
| SMILES | [18F]CCOc1cccc(-c2nncnn2)c1 |
| InChI | InChI=1S/C10H9FN4O/c11-4-5-16-9-3-1-2-8(6-9)10-14-12-7-13-15-10/h1-3,6-7H,4-5H2/i11-1 |
| InChIKey | CPINRSYGIAAQBL-KXMUYVCJSA-N |
| XLogP | 1.28 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |