C14H17NOS — CID 82479970
[4-(2-methoxy-4,5-dimethylphenyl)thiophen-3-yl]methanamine (PubChem CID 82479970) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is [4-(2-methoxy-4,5-dimethylphenyl)thiophen-3-yl]methanamine.
| Compound Name | [4-(2-methoxy-4,5-dimethylphenyl)thiophen-3-yl]methanamine |
|---|---|
| PubChem CID | 82479970 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | [4-(2-methoxy-4,5-dimethylphenyl)thiophen-3-yl]methanamine |
| SMILES | COc1cc(C)c(C)cc1-c1cscc1CN |
| InChI | InChI=1S/C14H17NOS/c1-9-4-12(14(16-3)5-10(9)2)13-8-17-7-11(13)6-15/h4-5,7-8H,6,15H2,1-3H3 |
| InChIKey | IDSACZQACSSACW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |