C12H15N3OS — CID 82480643
4-(5-ethyl-2-methoxyphenyl)-1,3-thiazole-2,5-diamine (PubChem CID 82480643) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 4-(5-ethyl-2-methoxyphenyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 4-(5-ethyl-2-methoxyphenyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 82480643 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-(5-ethyl-2-methoxyphenyl)-1,3-thiazole-2,5-diamine |
| SMILES | CCc1ccc(OC)c(-c2nc(N)sc2N)c1 |
| InChI | InChI=1S/C12H15N3OS/c1-3-7-4-5-9(16-2)8(6-7)10-11(13)17-12(14)15-10/h4-6H,3,13H2,1-2H3,(H2,14,15) |
| InChIKey | NHGFHHZSKLHAIF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |