C11H7F2N3S — CID 82481126
3-(3,4-difluorophenyl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 82481126) has the molecular formula C11H7F2N3S and a molecular weight of 251.26 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 3-(3,4-difluorophenyl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 82481126 |
| Molecular Formula | C11H7F2N3S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 3-(3,4-difluorophenyl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | Nc1cn2c(-c3ccc(F)c(F)c3)csc2n1 |
| InChI | InChI=1S/C11H7F2N3S/c12-7-2-1-6(3-8(7)13)9-5-17-11-15-10(14)4-16(9)11/h1-5H,14H2 |
| InChIKey | UTAISQRTIZJCGU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |