2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid

C11H7F2NO2S — CID 82482171

IUPAC2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(Cc2cc(F)ccc2F)n1
InChIInChI=1S/C11H7F2NO2S/c12-7-1-2-8(13)6(3-7)4-10-14-9(5-17-10)11(15)16/h1-3,5H,4H2,(H,15,16)
InChIKeyKDUXHUYSZDZKDA-UHFFFAOYSA-N
MW255.24 g/mol
LogP2.71
Rot. Bonds3

About 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid

2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 82482171) has the molecular formula C11H7F2NO2S and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid
PubChem CID82482171
Molecular FormulaC11H7F2NO2S
Molecular Weight255.24 g/mol
Exact Mass255.02
IUPAC Name2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(Cc2cc(F)ccc2F)n1
InChIInChI=1S/C11H7F2NO2S/c12-7-1-2-8(13)6(3-7)4-10-14-9(5-17-10)11(15)16/h1-3,5H,4H2,(H,15,16)
InChIKeyKDUXHUYSZDZKDA-UHFFFAOYSA-N
XLogP2.71
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.24
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (CID 82482171) is 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(Cc2cc(F)ccc2F)n1.
What is the InChIKey of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is KDUXHUYSZDZKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2NO2S/c12-7-1-2-8(13)6(3-7)4-10-14-9(5-17-10)11(15)16/h1-3,5H,4H2,(H,15,16).
What are the key properties of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 255.24 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 82482171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).