About 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid
2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 82482171) has the molecular formula C11H7F2NO2S
and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid.
Analyze 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (CID 82482171) is 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(Cc2cc(F)ccc2F)n1.
What is the InChIKey of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is KDUXHUYSZDZKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2NO2S/c12-7-1-2-8(13)6(3-7)4-10-14-9(5-17-10)11(15)16/h1-3,5H,4H2,(H,15,16).
What are the key properties of 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid?
2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 255.24 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-difluorophenyl)methyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 82482171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).