C13H14N4S — CID 82483652
5-(2,4,5-trimethylphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-amine (PubChem CID 82483652) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 5-(2,4,5-trimethylphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-amine.
| Compound Name | 5-(2,4,5-trimethylphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-amine |
|---|---|
| PubChem CID | 82483652 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-(2,4,5-trimethylphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-amine |
| SMILES | Cc1cc(C)c(-c2csc3nnc(N)n23)cc1C |
| InChI | InChI=1S/C13H14N4S/c1-7-4-9(3)10(5-8(7)2)11-6-18-13-16-15-12(14)17(11)13/h4-6H,1-3H3,(H2,14,15) |
| InChIKey | GTJPRQPNEGNKMT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |