C17H26N2 — CID 82483749
2-(4-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane (PubChem CID 82483749) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-(4-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-(4-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 82483749 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-(4-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)c1ccc(N2CCC3(CCNCC3)C2)cc1 |
| InChI | InChI=1S/C17H26N2/c1-14(2)15-3-5-16(6-4-15)19-12-9-17(13-19)7-10-18-11-8-17/h3-6,14,18H,7-13H2,1-2H3 |
| InChIKey | TUSLQRNRYYLYFE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|