C15H22N2 — CID 164739201
1-methyl-6-(4-propan-2-ylphenyl)-1,6-diazaspiro[3.3]heptane (PubChem CID 164739201) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 1-methyl-6-(4-propan-2-ylphenyl)-1,6-diazaspiro[3.3]heptane.
| Compound Name | 1-methyl-6-(4-propan-2-ylphenyl)-1,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 164739201 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-methyl-6-(4-propan-2-ylphenyl)-1,6-diazaspiro[3.3]heptane |
| SMILES | CC(C)c1ccc(N2CC3(CCN3C)C2)cc1 |
| InChI | InChI=1S/C15H22N2/c1-12(2)13-4-6-14(7-5-13)17-10-15(11-17)8-9-16(15)3/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | DFSZZDXGAHTQNS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|