C16H16N4 — CID 82486367
4-[3-(1,2,4-benzotriazin-3-yl)propyl]aniline (PubChem CID 82486367) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[3-(1,2,4-benzotriazin-3-yl)propyl]aniline.
| Compound Name | 4-[3-(1,2,4-benzotriazin-3-yl)propyl]aniline |
|---|---|
| PubChem CID | 82486367 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-[3-(1,2,4-benzotriazin-3-yl)propyl]aniline |
| SMILES | Nc1ccc(CCCc2nnc3ccccc3n2)cc1 |
| InChI | InChI=1S/C16H16N4/c17-13-10-8-12(9-11-13)4-3-7-16-18-14-5-1-2-6-15(14)19-20-16/h1-2,5-6,8-11H,3-4,7,17H2 |
| InChIKey | PUWCWEGVMPGUBV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|