C11H13NO — CID 82490544
5-methoxy-3,7-dimethyl-1H-indole (PubChem CID 82490544) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-methoxy-3,7-dimethyl-1H-indole.
| Compound Name | 5-methoxy-3,7-dimethyl-1H-indole |
|---|---|
| PubChem CID | 82490544 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-methoxy-3,7-dimethyl-1H-indole |
| SMILES | COc1cc(C)c2[nH]cc(C)c2c1 |
| InChI | InChI=1S/C11H13NO/c1-7-4-9(13-3)5-10-8(2)6-12-11(7)10/h4-6,12H,1-3H3 |
| InChIKey | WLGLLOVBRHAHOL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |