C13H18N2O — CID 82493658
1-(5-methoxy-2,7-dimethyl-1H-indol-3-yl)-N-methylmethanamine (PubChem CID 82493658) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(5-methoxy-2,7-dimethyl-1H-indol-3-yl)-N-methylmethanamine.
| Compound Name | 1-(5-methoxy-2,7-dimethyl-1H-indol-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 82493658 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(5-methoxy-2,7-dimethyl-1H-indol-3-yl)-N-methylmethanamine |
| SMILES | CNCc1c(C)[nH]c2c(C)cc(OC)cc12 |
| InChI | InChI=1S/C13H18N2O/c1-8-5-10(16-4)6-11-12(7-14-3)9(2)15-13(8)11/h5-6,14-15H,7H2,1-4H3 |
| InChIKey | QLFDBTQJBATKGD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|