C13H18N2 — CID 82491687
3-(5,7-dimethylindol-1-yl)propan-1-amine (PubChem CID 82491687) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(5,7-dimethylindol-1-yl)propan-1-amine.
| Compound Name | 3-(5,7-dimethylindol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 82491687 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-(5,7-dimethylindol-1-yl)propan-1-amine |
| SMILES | Cc1cc(C)c2c(ccn2CCCN)c1 |
| InChI | InChI=1S/C13H18N2/c1-10-8-11(2)13-12(9-10)4-7-15(13)6-3-5-14/h4,7-9H,3,5-6,14H2,1-2H3 |
| InChIKey | BPRQGZGFOYLBAB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |