C14H20N2 — CID 83968682
4-(5,7-dimethylindol-1-yl)butan-1-amine (PubChem CID 83968682) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 4-(5,7-dimethylindol-1-yl)butan-1-amine.
| Compound Name | 4-(5,7-dimethylindol-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 83968682 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 4-(5,7-dimethylindol-1-yl)butan-1-amine |
| SMILES | Cc1cc(C)c2c(ccn2CCCCN)c1 |
| InChI | InChI=1S/C14H20N2/c1-11-9-12(2)14-13(10-11)5-8-16(14)7-4-3-6-15/h5,8-10H,3-4,6-7,15H2,1-2H3 |
| InChIKey | SRWUTFWUMFKQOI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|