C13H19N3 — CID 139389752
6-pyrrolo[2,3-c]pyridin-1-ylhexan-1-amine (PubChem CID 139389752) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 6-pyrrolo[2,3-c]pyridin-1-ylhexan-1-amine.
| Compound Name | 6-pyrrolo[2,3-c]pyridin-1-ylhexan-1-amine |
|---|---|
| PubChem CID | 139389752 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 6-pyrrolo[2,3-c]pyridin-1-ylhexan-1-amine |
| SMILES | NCCCCCCn1ccc2ccncc21 |
| InChI | InChI=1S/C13H19N3/c14-7-3-1-2-4-9-16-10-6-12-5-8-15-11-13(12)16/h5-6,8,10-11H,1-4,7,9,14H2 |
| InChIKey | MNVRWQOCTPPYNB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|