C19H22N4O2 — CID 135308320
methyl 2-[1-(5-aminopentyl)pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylate (PubChem CID 135308320) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is methyl 2-[1-(5-aminopentyl)pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylate.
| Compound Name | methyl 2-[1-(5-aminopentyl)pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 135308320 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl 2-[1-(5-aminopentyl)pyrrolo[2,3-c]pyridin-5-yl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(-c2cc3ccn(CCCCCN)c3cn2)c1 |
| InChI | InChI=1S/C19H22N4O2/c1-25-19(24)15-5-8-21-16(12-15)17-11-14-6-10-23(18(14)13-22-17)9-4-2-3-7-20/h5-6,8,10-13H,2-4,7,9,20H2,1H3 |
| InChIKey | QRAOZOJPMZPQSN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|