C22H27N3O2 — CID 135308411
methyl 2-(1-octylpyrrolo[2,3-c]pyridin-5-yl)pyridine-4-carboxylate (PubChem CID 135308411) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl 2-(1-octylpyrrolo[2,3-c]pyridin-5-yl)pyridine-4-carboxylate.
| Compound Name | methyl 2-(1-octylpyrrolo[2,3-c]pyridin-5-yl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 135308411 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | methyl 2-(1-octylpyrrolo[2,3-c]pyridin-5-yl)pyridine-4-carboxylate |
| SMILES | CCCCCCCCn1ccc2cc(-c3cc(C(=O)OC)ccn3)ncc21 |
| InChI | InChI=1S/C22H27N3O2/c1-3-4-5-6-7-8-12-25-13-10-17-14-20(24-16-21(17)25)19-15-18(9-11-23-19)22(26)27-2/h9-11,13-16H,3-8,12H2,1-2H3 |
| InChIKey | IFLPPHUTBXEUGC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|