C14H14N2O2 — CID 82497233
(E)-3-(2-cyclopropyl-1-methylbenzimidazol-5-yl)prop-2-enoic acid (PubChem CID 82497233) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (E)-3-(2-cyclopropyl-1-methylbenzimidazol-5-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-cyclopropyl-1-methylbenzimidazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82497233 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (E)-3-(2-cyclopropyl-1-methylbenzimidazol-5-yl)prop-2-enoic acid |
| SMILES | Cn1c(C2CC2)nc2cc(/C=C/C(=O)O)ccc21 |
| InChI | InChI=1S/C14H14N2O2/c1-16-12-6-2-9(3-7-13(17)18)8-11(12)15-14(16)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,17,18)/b7-3+ |
| InChIKey | LNBMACMHFZFPCY-XVNBXDOJSA-N |
| XLogP | 2.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|