C17H26N2 — CID 82500229
3-methyl-2-(1,2,5,7-tetramethylindol-3-yl)butan-1-amine (PubChem CID 82500229) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 3-methyl-2-(1,2,5,7-tetramethylindol-3-yl)butan-1-amine.
| Compound Name | 3-methyl-2-(1,2,5,7-tetramethylindol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 82500229 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3-methyl-2-(1,2,5,7-tetramethylindol-3-yl)butan-1-amine |
| SMILES | Cc1cc(C)c2c(c1)c(C(CN)C(C)C)c(C)n2C |
| InChI | InChI=1S/C17H26N2/c1-10(2)15(9-18)16-13(5)19(6)17-12(4)7-11(3)8-14(16)17/h7-8,10,15H,9,18H2,1-6H3 |
| InChIKey | LDXUGQRGZSYWCC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|