C15H21N3O — CID 82500369
5-(2-amino-1-cyclohexylethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 82500369) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-(2-amino-1-cyclohexylethyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(2-amino-1-cyclohexylethyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 82500369 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 5-(2-amino-1-cyclohexylethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | NCC(c1ccc2[nH]c(=O)[nH]c2c1)C1CCCCC1 |
| InChI | InChI=1S/C15H21N3O/c16-9-12(10-4-2-1-3-5-10)11-6-7-13-14(8-11)18-15(19)17-13/h6-8,10,12H,1-5,9,16H2,(H2,17,18,19) |
| InChIKey | GPLUEKGDIWEUMN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |