C16H19NO3 — CID 82502109
4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid (PubChem CID 82502109) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid.
| Compound Name | 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 82502109 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid |
| SMILES | Cc1cc(C)c2c(C(=O)CCC(=O)O)c(C)n(C)c2c1 |
| InChI | InChI=1S/C16H19NO3/c1-9-7-10(2)15-12(8-9)17(4)11(3)16(15)13(18)5-6-14(19)20/h7-8H,5-6H2,1-4H3,(H,19,20) |
| InChIKey | BOESFBXJFZQZMW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |