4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid

C16H19NO3 — CID 82502109

IUPAC4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid
SMILESCc1cc(C)c2c(C(=O)CCC(=O)O)c(C)n(C)c2c1
InChIInChI=1S/C16H19NO3/c1-9-7-10(2)15-12(8-9)17(4)11(3)16(15)13(18)5-6-14(19)20/h7-8H,5-6H2,1-4H3,(H,19,20)
InChIKeyBOESFBXJFZQZMW-UHFFFAOYSA-N
MW273.33 g/mol
LogP3.15
Rot. Bonds4

About 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid

4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid (PubChem CID 82502109) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid.

Molecular Properties

Compound Name4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid
PubChem CID82502109
Molecular FormulaC16H19NO3
Molecular Weight273.33 g/mol
Exact Mass273.14
IUPAC Name4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid
SMILESCc1cc(C)c2c(C(=O)CCC(=O)O)c(C)n(C)c2c1
InChIInChI=1S/C16H19NO3/c1-9-7-10(2)15-12(8-9)17(4)11(3)16(15)13(18)5-6-14(19)20/h7-8H,5-6H2,1-4H3,(H,19,20)
InChIKeyBOESFBXJFZQZMW-UHFFFAOYSA-N
XLogP3.15
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.33
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid?
The IUPAC name of 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid (CID 82502109) is 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid.
What is the SMILES notation for 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid?
The canonical SMILES for 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid is Cc1cc(C)c2c(C(=O)CCC(=O)O)c(C)n(C)c2c1.
What is the InChIKey of 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid?
The InChIKey is BOESFBXJFZQZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-9-7-10(2)15-12(8-9)17(4)11(3)16(15)13(18)5-6-14(19)20/h7-8H,5-6H2,1-4H3,(H,19,20).
What are the key properties of 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid?
4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid has a molecular weight of 273.33 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-(1,2,4,6-tetramethylindol-3-yl)butanoic acid is sourced from PubChem (CID 82502109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).