C12H16N2 — CID 82504499
(2-propylisoindol-5-yl)methanamine (PubChem CID 82504499) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2-propylisoindol-5-yl)methanamine.
| Compound Name | (2-propylisoindol-5-yl)methanamine |
|---|---|
| PubChem CID | 82504499 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2-propylisoindol-5-yl)methanamine |
| SMILES | CCCn1cc2ccc(CN)cc2c1 |
| InChI | InChI=1S/C12H16N2/c1-2-5-14-8-11-4-3-10(7-13)6-12(11)9-14/h3-4,6,8-9H,2,5,7,13H2,1H3 |
| InChIKey | NEOXUVVBKQPMCM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |