C12H16N2O — CID 82506736
N-[3-(aminomethyl)-4,5-dimethylphenyl]prop-2-enamide (PubChem CID 82506736) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-[3-(aminomethyl)-4,5-dimethylphenyl]prop-2-enamide.
| Compound Name | N-[3-(aminomethyl)-4,5-dimethylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 82506736 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-[3-(aminomethyl)-4,5-dimethylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(C)c(C)c(CN)c1 |
| InChI | InChI=1S/C12H16N2O/c1-4-12(15)14-11-5-8(2)9(3)10(6-11)7-13/h4-6H,1,7,13H2,2-3H3,(H,14,15) |
| InChIKey | NHRWVNZCXPQUMT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|