C10H15N3O2 — CID 82507791
5-(aminomethyl)-1-(1,2-oxazol-4-ylmethyl)piperidin-2-one (PubChem CID 82507791) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-(aminomethyl)-1-(1,2-oxazol-4-ylmethyl)piperidin-2-one.
| Compound Name | 5-(aminomethyl)-1-(1,2-oxazol-4-ylmethyl)piperidin-2-one |
|---|---|
| PubChem CID | 82507791 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 5-(aminomethyl)-1-(1,2-oxazol-4-ylmethyl)piperidin-2-one |
| SMILES | NCC1CCC(=O)N(Cc2cnoc2)C1 |
| InChI | InChI=1S/C10H15N3O2/c11-3-8-1-2-10(14)13(5-8)6-9-4-12-15-7-9/h4,7-8H,1-3,5-6,11H2 |
| InChIKey | RFCMGUVGXOXXOE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |