C11H13N5 — CID 82509043
5-(aminomethyl)-N-methyl-2-pyridin-2-ylpyrimidin-4-amine (PubChem CID 82509043) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 5-(aminomethyl)-N-methyl-2-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | 5-(aminomethyl)-N-methyl-2-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82509043 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 5-(aminomethyl)-N-methyl-2-pyridin-2-ylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccccn2)ncc1CN |
| InChI | InChI=1S/C11H13N5/c1-13-10-8(6-12)7-15-11(16-10)9-4-2-3-5-14-9/h2-5,7H,6,12H2,1H3,(H,13,15,16) |
| InChIKey | KSQUSSVRBOSDPC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |