C12H24N4O — CID 82511399
3-methyl-N-(2-piperazin-1-ylethyl)pyrrolidine-1-carboxamide (PubChem CID 82511399) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-methyl-N-(2-piperazin-1-ylethyl)pyrrolidine-1-carboxamide.
| Compound Name | 3-methyl-N-(2-piperazin-1-ylethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 82511399 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 3-methyl-N-(2-piperazin-1-ylethyl)pyrrolidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NCCN2CCNCC2)C1 |
| InChI | InChI=1S/C12H24N4O/c1-11-2-6-16(10-11)12(17)14-5-9-15-7-3-13-4-8-15/h11,13H,2-10H2,1H3,(H,14,17) |
| InChIKey | HCUKPFBURABMOO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |