C12H15FN4 — CID 82513216
4-fluoro-3-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)aniline (PubChem CID 82513216) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-fluoro-3-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)aniline.
| Compound Name | 4-fluoro-3-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 82513216 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-fluoro-3-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)aniline |
| SMILES | Cc1nc(C(C)C)nn1-c1cc(N)ccc1F |
| InChI | InChI=1S/C12H15FN4/c1-7(2)12-15-8(3)17(16-12)11-6-9(14)4-5-10(11)13/h4-7H,14H2,1-3H3 |
| InChIKey | RXBPKZUDIZQXOQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|