4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid

C10H14BrNO2 — CID 82514165

IUPAC4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid
SMILESCc1cc(Br)c(C)n1CCCC(=O)O
InChIInChI=1S/C10H14BrNO2/c1-7-6-9(11)8(2)12(7)5-3-4-10(13)14/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeyLRLFXWBTRBASID-UHFFFAOYSA-N
MW260.13 g/mol
LogP2.73
Rot. Bonds4

About 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid

4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid (PubChem CID 82514165) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid.

Molecular Properties

Compound Name4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid
PubChem CID82514165
Molecular FormulaC10H14BrNO2
Molecular Weight260.13 g/mol
Exact Mass259.02
IUPAC Name4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid
SMILESCc1cc(Br)c(C)n1CCCC(=O)O
InChIInChI=1S/C10H14BrNO2/c1-7-6-9(11)8(2)12(7)5-3-4-10(13)14/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeyLRLFXWBTRBASID-UHFFFAOYSA-N
XLogP2.73
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.13
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid?
The IUPAC name of 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid (CID 82514165) is 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid.
What is the SMILES notation for 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid?
The canonical SMILES for 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid is Cc1cc(Br)c(C)n1CCCC(=O)O.
What is the InChIKey of 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid?
The InChIKey is LRLFXWBTRBASID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrNO2/c1-7-6-9(11)8(2)12(7)5-3-4-10(13)14/h6H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid?
4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid has a molecular weight of 260.13 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-2,5-dimethylpyrrol-1-yl)butanoic acid is sourced from PubChem (CID 82514165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).