C20H20N2O8 — CID 102274603
5-[2-(4-carboxybutyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]pentanoic acid (PubChem CID 102274603) has the molecular formula C20H20N2O8 and a molecular weight of 416.39 g/mol. Its IUPAC name is 5-[2-(4-carboxybutyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]pentanoic acid.
| Compound Name | 5-[2-(4-carboxybutyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]pentanoic acid |
|---|---|
| PubChem CID | 102274603 |
| Molecular Formula | C20H20N2O8 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-[2-(4-carboxybutyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]pentanoic acid |
| SMILES | O=C(O)CCCCn1c(=O)c2cc3c(=O)n(CCCCC(=O)O)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C20H20N2O8/c23-15(24)5-1-3-7-21-17(27)11-9-13-14(10-12(11)18(21)28)20(30)22(19(13)29)8-4-2-6-16(25)26/h9-10H,1-8H2,(H,23,24)(H,25,26) |
| InChIKey | OPQLYJFSVYKKFW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 152.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|