C18H19NO5 — CID 11404713
6-octylfuro[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 11404713) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 6-octylfuro[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-octylfuro[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 11404713 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 6-octylfuro[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCCCCCCCn1c(=O)c2cc3c(=O)oc(=O)c3cc2c1=O |
| InChI | InChI=1S/C18H19NO5/c1-2-3-4-5-6-7-8-19-15(20)11-9-13-14(10-12(11)16(19)21)18(23)24-17(13)22/h9-10H,2-8H2,1H3 |
| InChIKey | NOWJGEIWVVEZLY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|