C13H15N3O3 — CID 82514233
2-[3-(3-ethyl-1,2,4-triazol-4-yl)-4-methoxyphenyl]acetic acid (PubChem CID 82514233) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[3-(3-ethyl-1,2,4-triazol-4-yl)-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-(3-ethyl-1,2,4-triazol-4-yl)-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 82514233 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[3-(3-ethyl-1,2,4-triazol-4-yl)-4-methoxyphenyl]acetic acid |
| SMILES | CCc1nncn1-c1cc(CC(=O)O)ccc1OC |
| InChI | InChI=1S/C13H15N3O3/c1-3-12-15-14-8-16(12)10-6-9(7-13(17)18)4-5-11(10)19-2/h4-6,8H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | VMACVHWBTHMHRW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |