C12H12Cl2N2S — CID 82515973
2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]propan-2-amine (PubChem CID 82515973) has the molecular formula C12H12Cl2N2S and a molecular weight of 287.22 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]propan-2-amine.
| Compound Name | 2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 82515973 |
| Molecular Formula | C12H12Cl2N2S |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]propan-2-amine |
| SMILES | CC(C)(N)c1csc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H12Cl2N2S/c1-12(2,15)10-6-17-11(16-10)8-4-3-7(13)5-9(8)14/h3-6H,15H2,1-2H3 |
| InChIKey | ZQPNDZLRGTXIJG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |