C17H22N2O3 — CID 82517620
6-(3,4-dimethoxyphenyl)-3-(propylaminomethyl)-1H-pyridin-2-one (PubChem CID 82517620) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-3-(propylaminomethyl)-1H-pyridin-2-one.
| Compound Name | 6-(3,4-dimethoxyphenyl)-3-(propylaminomethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 82517620 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-3-(propylaminomethyl)-1H-pyridin-2-one |
| SMILES | CCCNCc1ccc(-c2ccc(OC)c(OC)c2)[nH]c1=O |
| InChI | InChI=1S/C17H22N2O3/c1-4-9-18-11-13-5-7-14(19-17(13)20)12-6-8-15(21-2)16(10-12)22-3/h5-8,10,18H,4,9,11H2,1-3H3,(H,19,20) |
| InChIKey | AXEZTUOBJQQLAT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|