C19H23NO2 — CID 82520206
6-(2,4-dimethylphenyl)-1-(3-methylbutyl)-2-oxopyridine-3-carbaldehyde (PubChem CID 82520206) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-1-(3-methylbutyl)-2-oxopyridine-3-carbaldehyde.
| Compound Name | 6-(2,4-dimethylphenyl)-1-(3-methylbutyl)-2-oxopyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 82520206 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-1-(3-methylbutyl)-2-oxopyridine-3-carbaldehyde |
| SMILES | Cc1ccc(-c2ccc(C=O)c(=O)n2CCC(C)C)c(C)c1 |
| InChI | InChI=1S/C19H23NO2/c1-13(2)9-10-20-18(8-6-16(12-21)19(20)22)17-7-5-14(3)11-15(17)4/h5-8,11-13H,9-10H2,1-4H3 |
| InChIKey | PJRWVEKENJCKHP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|