C10H16N2O — CID 82526333
3-(ethylaminomethyl)-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 82526333) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-(ethylaminomethyl)-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 82526333 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-(ethylaminomethyl)-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | CCNCc1c(C)cc(C)[nH]c1=O |
| InChI | InChI=1S/C10H16N2O/c1-4-11-6-9-7(2)5-8(3)12-10(9)13/h5,11H,4,6H2,1-3H3,(H,12,13) |
| InChIKey | UROFNPUAMSVZAH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |