C11H11BrN4 — CID 82528338
1-(4-bromophenyl)-5-methylpyrazole-4-carboximidamide (PubChem CID 82528338) has the molecular formula C11H11BrN4 and a molecular weight of 279.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-methylpyrazole-4-carboximidamide.
| Compound Name | 1-(4-bromophenyl)-5-methylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 82528338 |
| Molecular Formula | C11H11BrN4 |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1-(4-bromophenyl)-5-methylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnn(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C11H11BrN4/c1-7-10(11(13)14)6-15-16(7)9-4-2-8(12)3-5-9/h2-6H,1H3,(H3,13,14) |
| InChIKey | DYLTWBCNYOBYTH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|