C11H8FN3S — CID 82528948
8-fluoro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine (PubChem CID 82528948) has the molecular formula C11H8FN3S and a molecular weight of 233.27 g/mol. Its IUPAC name is 8-fluoro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 8-fluoro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 82528948 |
| Molecular Formula | C11H8FN3S |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 8-fluoro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Nc1c(-c2cccs2)nc2c(F)cccn12 |
| InChI | InChI=1S/C11H8FN3S/c12-7-3-1-5-15-10(13)9(14-11(7)15)8-4-2-6-16-8/h1-6H,13H2 |
| InChIKey | KWEYMTAIPUACID-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |