C9H8BrN3S — CID 82530100
7-bromo-2-methylimidazo[1,2-a]pyridine-3-carbothioamide (PubChem CID 82530100) has the molecular formula C9H8BrN3S and a molecular weight of 270.16 g/mol. Its IUPAC name is 7-bromo-2-methylimidazo[1,2-a]pyridine-3-carbothioamide.
| Compound Name | 7-bromo-2-methylimidazo[1,2-a]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 82530100 |
| Molecular Formula | C9H8BrN3S |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 7-bromo-2-methylimidazo[1,2-a]pyridine-3-carbothioamide |
| SMILES | Cc1nc2cc(Br)ccn2c1C(N)=S |
| InChI | InChI=1S/C9H8BrN3S/c1-5-8(9(11)14)13-3-2-6(10)4-7(13)12-5/h2-4H,1H3,(H2,11,14) |
| InChIKey | ISPCZWOTHHHFAU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|