About 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid
2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid (PubChem CID 82530556) has the molecular formula C10H8ClN3O3
and a molecular weight of 253.64 g/mol. Its IUPAC name is 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid |
| PubChem CID | 82530556 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid |
| SMILES | Cc1cc(Cl)c2nc(CC(=O)O)c(N=O)n2c1 |
| InChI | InChI=1S/C10H8ClN3O3/c1-5-2-6(11)9-12-7(3-8(15)16)10(13-17)14(9)4-5/h2,4H,3H2,1H3,(H,15,16) |
| InChIKey | QOJVVZTWFGSERP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid?
The IUPAC name of 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid (CID 82530556) is 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid.
What is the SMILES notation for 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid?
The canonical SMILES for 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid is Cc1cc(Cl)c2nc(CC(=O)O)c(N=O)n2c1.
What is the InChIKey of 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid?
The InChIKey is QOJVVZTWFGSERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O3/c1-5-2-6(11)9-12-7(3-8(15)16)10(13-17)14(9)4-5/h2,4H,3H2,1H3,(H,15,16).
What are the key properties of 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid?
2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid has a molecular weight of 253.64 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-chloro-6-methyl-3-nitrosoimidazo[1,2-a]pyridin-2-yl)acetic acid is sourced from PubChem (CID 82530556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).