C11H11BrN2OS — CID 82531499
N-(2-bromophenyl)-2-(2-cyanoethylsulfanyl)acetamide (PubChem CID 82531499) has the molecular formula C11H11BrN2OS and a molecular weight of 299.19 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(2-cyanoethylsulfanyl)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(2-cyanoethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 82531499 |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | N-(2-bromophenyl)-2-(2-cyanoethylsulfanyl)acetamide |
| SMILES | N#CCCSCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C11H11BrN2OS/c12-9-4-1-2-5-10(9)14-11(15)8-16-7-3-6-13/h1-2,4-5H,3,7-8H2,(H,14,15) |
| InChIKey | PMBBHUMEUQEDNJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|