C11H11ClN2OS — CID 82181411
N-(3-chlorophenyl)-2-(2-cyanoethylsulfanyl)acetamide (PubChem CID 82181411) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2-cyanoethylsulfanyl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(2-cyanoethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 82181411 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2-cyanoethylsulfanyl)acetamide |
| SMILES | N#CCCSCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2OS/c12-9-3-1-4-10(7-9)14-11(15)8-16-6-2-5-13/h1,3-4,7H,2,6,8H2,(H,14,15) |
| InChIKey | KWJGDGNWTKQNBF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|