C13H15ClN2OS — CID 106428862
N-(3-chlorophenyl)-2-(2-prop-2-ynylsulfanylethylamino)acetamide (PubChem CID 106428862) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2-prop-2-ynylsulfanylethylamino)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(2-prop-2-ynylsulfanylethylamino)acetamide |
|---|---|
| PubChem CID | 106428862 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2-prop-2-ynylsulfanylethylamino)acetamide |
| SMILES | C#CCSCCNCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2OS/c1-2-7-18-8-6-15-10-13(17)16-12-5-3-4-11(14)9-12/h1,3-5,9,15H,6-8,10H2,(H,16,17) |
| InChIKey | MZPCXCQJLHWFGK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|