About 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate
1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate (PubChem CID 82533507) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate.
Molecular Properties
| Compound Name | 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate |
| PubChem CID | 82533507 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate |
| SMILES | Cc1ccc(CNCC(C)OC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-12(2)9-16(18)19-14(4)10-17-11-15-7-5-13(3)6-8-15/h5-8,12,14,17H,9-11H2,1-4H3 |
| InChIKey | KSYJZZXONZCDRY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate?
The IUPAC name of 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate (CID 82533507) is 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate.
What is the SMILES notation for 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate?
The canonical SMILES for 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate is Cc1ccc(CNCC(C)OC(=O)CC(C)C)cc1.
What is the InChIKey of 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate?
The InChIKey is KSYJZZXONZCDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-12(2)9-16(18)19-14(4)10-17-11-15-7-5-13(3)6-8-15/h5-8,12,14,17H,9-11H2,1-4H3.
What are the key properties of 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate?
1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate has a molecular weight of 263.38 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methylphenyl)methylamino]propan-2-yl 3-methylbutanoate is sourced from PubChem (CID 82533507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).