About 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine
2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 82534397) has the molecular formula C9H8F5N
and a molecular weight of 225.16 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine.
Analyze 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine?
The IUPAC name of 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine (CID 82534397) is 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine.
What is the SMILES notation for 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine?
The canonical SMILES for 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine is NCC(c1cc(F)ccc1F)C(F)(F)F.
What is the InChIKey of 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine?
The InChIKey is OSCGTWMHAUUSDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F5N/c10-5-1-2-8(11)6(3-5)7(4-15)9(12,13)14/h1-3,7H,4,15H2.
What are the key properties of 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine?
2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine has a molecular weight of 225.16 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)-3,3,3-trifluoropropan-1-amine is sourced from PubChem (CID 82534397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).