C10H11ClF3N — CID 82534388
2-(5-chloro-2-methylphenyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 82534388) has the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. Its IUPAC name is 2-(5-chloro-2-methylphenyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 2-(5-chloro-2-methylphenyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 82534388 |
| Molecular Formula | C10H11ClF3N |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-(5-chloro-2-methylphenyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | Cc1ccc(Cl)cc1C(CN)C(F)(F)F |
| InChI | InChI=1S/C10H11ClF3N/c1-6-2-3-7(11)4-8(6)9(5-15)10(12,13)14/h2-4,9H,5,15H2,1H3 |
| InChIKey | RZWKMSLTXGBENM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |