C9H14F3NO2 — CID 82534483
(Z)-3-[2-(dimethylamino)ethyl]-5,5,5-trifluoropent-2-enoic acid (PubChem CID 82534483) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is (Z)-3-[2-(dimethylamino)ethyl]-5,5,5-trifluoropent-2-enoic acid.
| Compound Name | (Z)-3-[2-(dimethylamino)ethyl]-5,5,5-trifluoropent-2-enoic acid |
|---|---|
| PubChem CID | 82534483 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (Z)-3-[2-(dimethylamino)ethyl]-5,5,5-trifluoropent-2-enoic acid |
| SMILES | CN(C)CC/C(=C/C(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c1-13(2)4-3-7(5-8(14)15)6-9(10,11)12/h5H,3-4,6H2,1-2H3,(H,14,15)/b7-5- |
| InChIKey | ASHQVTVMLOAUMH-ALCCZGGFSA-N |
| XLogP | 1.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|