C15H15N3S — CID 82538975
N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]quinolin-8-amine (PubChem CID 82538975) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]quinolin-8-amine.
| Compound Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]quinolin-8-amine |
|---|---|
| PubChem CID | 82538975 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]quinolin-8-amine |
| SMILES | Cc1csc(CCNc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C15H15N3S/c1-11-10-19-14(18-11)7-9-16-13-6-2-4-12-5-3-8-17-15(12)13/h2-6,8,10,16H,7,9H2,1H3 |
| InChIKey | WZCDCELNOLTTHY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |