C17H19ClN2 — CID 82541625
1-[4-chloro-3-(1-methyl-2,3-dihydroindol-5-yl)phenyl]ethanamine (PubChem CID 82541625) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 1-[4-chloro-3-(1-methyl-2,3-dihydroindol-5-yl)phenyl]ethanamine.
| Compound Name | 1-[4-chloro-3-(1-methyl-2,3-dihydroindol-5-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 82541625 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-[4-chloro-3-(1-methyl-2,3-dihydroindol-5-yl)phenyl]ethanamine |
| SMILES | CC(N)c1ccc(Cl)c(-c2ccc3c(c2)CCN3C)c1 |
| InChI | InChI=1S/C17H19ClN2/c1-11(19)12-3-5-16(18)15(10-12)13-4-6-17-14(9-13)7-8-20(17)2/h3-6,9-11H,7-8,19H2,1-2H3 |
| InChIKey | JCVSFCLDBDNMOA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |