C16H15NO4 — CID 82543122
3-[5-(1,3-benzodioxol-5-yl)-3-pyridinyl]butanoic acid (PubChem CID 82543122) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[5-(1,3-benzodioxol-5-yl)-3-pyridinyl]butanoic acid.
| Compound Name | 3-[5-(1,3-benzodioxol-5-yl)-3-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 82543122 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-[5-(1,3-benzodioxol-5-yl)-3-pyridinyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1cncc(-c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H15NO4/c1-10(4-16(18)19)12-5-13(8-17-7-12)11-2-3-14-15(6-11)21-9-20-14/h2-3,5-8,10H,4,9H2,1H3,(H,18,19) |
| InChIKey | MWNBFTWGAZVHBK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |