C15H14N2O4 — CID 58833072
5-(1,3-benzodioxol-5-yl)-N-(2-hydroxyethyl)pyridine-3-carboxamide (PubChem CID 58833072) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-(2-hydroxyethyl)pyridine-3-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-(2-hydroxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58833072 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-(2-hydroxyethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCO)c1cncc(-c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C15H14N2O4/c18-4-3-17-15(19)12-5-11(7-16-8-12)10-1-2-13-14(6-10)21-9-20-13/h1-2,5-8,18H,3-4,9H2,(H,17,19) |
| InChIKey | MYRZZDVEECPSAR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |